| Product Name | 4-morpholinobenzylamine |
| CAS No. | 214759-74-7 |
| Synonyms | (4-morpholinophenyl)methanamine; [4-(Morpholin-4-yl)benzyl]amine |
| InChI | InChI=1/C11H16N2O/c12-9-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-9,12H2 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.2575 |
| Density | 1.113g/cm3 |
| Melting point | 44℃ |
| Boiling point | 361.354°C at 760 mmHg |
| Flash point | 172.341°C |
| Refractive index | 1.568 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
214759-74-7 4-morpholinobenzylamine
service@apichina.com