| Product Name | 4-Morpholinoacetophenone |
| CAS No. | 39910-98-0 |
| Synonyms | Acetophenone, 4'-morpholino-; BRN 1214737; p-Morpholinoacetophenone; 1-[4-(morpholin-4-yl)phenyl]ethanone |
| InChI | InChI=1/C12H15NO2/c1-10(14)11-2-4-12(5-3-11)13-6-8-15-9-7-13/h2-5H,6-9H2,1H3 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.253 |
| Density | 1.113g/cm3 |
| Melting point | 94-98℃ |
| Boiling point | 376.7°C at 760 mmHg |
| Flash point | 181.6°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
39910-98-0 4-morpholinoacetophenone
service@apichina.com