| Product Name | (4-morpholino-3-nitrophenyl)methanol hydrochloride |
| CAS No. | 300665-23-0 |
| Synonyms | (4-morpholin-4-yl-3-nitrophenyl)methanol hydrochloride |
| InChI | InChI=1/C11H14N2O4.ClH/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12;/h1-2,7,14H,3-6,8H2;1H |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.7008 |
| Melting point | 107℃ |
| Boiling point | 468.5°C at 760 mmHg |
| Flash point | 237.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
300665-23-0 (4-morpholino-3-nitrophenyl)methanol hydrochloride
service@apichina.com