| Product Name | 4-methylthiophene-2-carboxylic acid |
| CAS No. | 14282-78-1 |
| InChI | InChI=1/C6H6O2S/c1-4-2-5(6(7)8)9-3-4/h2-3H,1H3,(H,7,8) |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.1756 |
| Density | 1.319g/cm3 |
| Melting point | 122℃ |
| Boiling point | 277.2°C at 760 mmHg |
| Flash point | 121.5°C |
| Refractive index | 1.59 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
14282-78-1 4-methylthiophene-2-carboxylic acid
service@apichina.com