| Product Name | 4-(Methylthio)thiophenol |
| CAS No. | 1122-97-0 |
| Synonyms | 4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
| InChI | InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| Molecular Formula | C7H8S2 |
| Molecular Weight | 156.2684 |
| Density | 1.16g/cm3 |
| Boiling point | 252.9°C at 760 mmHg |
| Flash point | 106.7°C |
| Refractive index | 1.621 |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1122-97-0 4-(methylthio)thiophenol
service@apichina.com