| Product Name | 4-methylthiazole-5-carboxylic acid |
| CAS No. | 20485-41-0 |
| Synonyms | 4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
| InChI | InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.131g/cm3 |
| Melting point | 250℃ |
| Boiling point | 295.593°C at 760 mmHg |
| Flash point | 108.428°C |
| Refractive index | 1.611 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
20485-41-0 4-methylthiazole-5-carboxylic acid
service@apichina.com