| Product Name | (4-Methylphenoxy)acetic acid |
| CAS No. | 940-64-7 |
| Synonyms | 4-Methylphenoxyacetic acid; (p-Tolyloxy)-acetic acid; (4-methylphenoxy)acetate |
| InChI | InChI=1/C9H10O3/c1-7-2-4-8(5-3-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| Molecular Formula | C9H9O3 |
| Molecular Weight | 165.1665 |
| Melting point | 141-142℃ |
| Boiling point | 297.2°C at 760 mmHg |
| Flash point | 120°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
940-64-7 (4-methylphenoxy)acetic acid
service@apichina.com