| Product Name | 4-Methylnonanoic acid |
| CAS No. | 45019-28-1 |
| Synonyms | Nonanoic acid, 4-methyl-; 4-Methylpelargonic acid; AI3-30047; FEMA No. 3574; 4-Methylnonan-1-oic acid; (4R)-4-methylnonanoate; (4S)-4-methylnonanoate |
| InChI | InChI=1/C10H20O2/c1-3-4-5-6-9(2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)/p-1/t9-/m0/s1 |
| Molecular Formula | C10H19O2 |
| Molecular Weight | 171.2572 |
| Boiling point | 271.6°C at 760 mmHg |
| Flash point | 142.3°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
45019-28-1 4-methylnonanoic acid
service@apichina.com