| Product Name | 4-Methylformanilide |
| CAS No. | 3085-54-9 |
| Synonyms | 4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| InChI | InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.1632 |
| Density | 1.103g/cm3 |
| Boiling point | 293.5°C at 760 mmHg |
| Flash point | 166.8°C |
| Refractive index | 1.581 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
3085-54-9 4-methylformanilide
service@apichina.com