| Product Name | 4-Methylcyclohexanol, mixture of cis and trans |
| CAS No. | 589-91-3 |
| Synonyms | 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
| InChI | InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.1855 |
| Density | 0.925g/cm3 |
| Melting point | -41℃ |
| Boiling point | 170.322°C at 760 mmHg |
| Flash point | 70°C |
| Water solubility | slightly soluble |
| Refractive index | 1.463 |
| Safety | S24/25:; |
589-91-3 4-methylcyclohexanol, mixture of cis and trans
service@apichina.com