| Product Name | 4-Methylcatechol-O,O-diacetic acid |
| CAS No. | 5458-76-4 |
| Synonyms | 2,2'-((4-Methyl-1,2-phenylene)bis(oxy))bisacetic acid; 2,2'-[(4-methylbenzene-1,3-diyl)bis(oxy)]diacetic acid; 2,2'-[(4-methylbenzene-1,2-diyl)bis(oxy)]diacetic acid |
| InChI | InChI=1/C11H12O6/c1-7-2-3-8(16-5-10(12)13)9(4-7)17-6-11(14)15/h2-4H,5-6H2,1H3,(H,12,13)(H,14,15) |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.2094 |
| Density | 1.365g/cm3 |
| Boiling point | 439.2°C at 760 mmHg |
| Flash point | 172.7°C |
| Refractive index | 1.559 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5458-76-4 4-methylcatechol-o,o-diacetic acid
service@apichina.com