| Product Name | 4-Methylbenzyl mercaptan |
| CAS No. | 4498-99-1 |
| Synonyms | 4-Methyl-alpha-toluenethiol; (4-methylphenyl)methanethiol |
| InChI | InChI=1/C8H10S/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 |
| Density | 1.015g/cm3 |
| Boiling point | 217.7°C at 760 mmHg |
| Flash point | 85.6°C |
| Refractive index | 1.558 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
4498-99-1 4-methylbenzyl mercaptan
service@apichina.com