| Product Name | 4-Methylbenzyl acetate |
| CAS No. | 2216-45-7 |
| Synonyms | Benzenemethanol, 4-methyl-, 1-acetate; 4-06-00-03173 (Beilstein Handbook Reference); 4-Methylbenzenemethanol acetate; 4-Methylbenzyl ethanoate; AI3-20661; BRN 2046163; NSC 7001; p-Acetoxymethyltoluene; p-Methylbenzyl acetate; p-Methylbenzyl alcohol acetate; p-Tolubenzyl acetate; p-Xylene, alpha-acetoxy; p-Xylyl acetate; Benzenemethanol, 4-methyl-, acetate; Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI) |
| InChI | InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2011 |
| Density | 1.035g/cm3 |
| Boiling point | 224.5°C at 760 mmHg |
| Flash point | 98°C |
| Refractive index | 1.505 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2216-45-7 4-methylbenzyl acetate
service@apichina.com