| Product Name | 4-Methyl(thiobenzamide) |
| CAS No. | 2362-62-1 |
| Synonyms | 4-methylbenzene-1-carbothioamide; 4-methylbenzenecarbothioamide |
| InChI | InChI=1/C8H9NS/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H2,9,10) |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.2288 |
| Density | 1.143g/cm3 |
| Melting point | 166-169℃ |
| Boiling point | 258.9°C at 760 mmHg |
| Flash point | 110.4°C |
| Refractive index | 1.633 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2362-62-1 4-methyl(thiobenzamide)
service@apichina.com