| Product Name | 4-Methyl-3-nitrobenzeneboronic acid |
| CAS No. | 80500-27-2 |
| Synonyms | 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
| InChI | InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| Molecular Formula | C7H8BNO4 |
| Molecular Weight | 180.9537 |
| Density | 1.33g/cm3 |
| Melting point | 265-270 °C(lit.) |
| Boiling point | 356.7°C at 760 mmHg |
| Flash point | 169.5°C |
| Refractive index | 1.563 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
80500-27-2 4-methyl-3-nitrobenzeneboronic acid
service@apichina.com