| Product Name | 4-Methyl-3-heptanol |
| CAS No. | 14979-39-6 |
| Synonyms | 4-Methyl-3-heptanol,mixture of isomers; Ethyl 2-pentyl carbinol; 4-methylheptan-3-ol; (3R,4S)-4-methylheptan-3-ol; (3S,4S)-4-methylheptan-3-ol; (3R,4R)-4-methylheptan-3-ol; (3S,4R)-4-methylheptan-3-ol |
| InChI | InChI=1/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.2279 |
| Density | 0.819g/cm3 |
| Boiling point | 158.5°C at 760 mmHg |
| Flash point | 54.4°C |
| Refractive index | 1.424 |
| Risk Codes | R10:Flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
14979-39-6 4-methyl-3-heptanol
service@apichina.com