| Product Name | 4-Methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carbonyl chloride |
| CAS No. | 499770-73-9 |
| InChI | InChI=1/C10H10ClNO2/c1-12-4-5-14-9-6-7(10(11)13)2-3-8(9)12/h2-3,6H,4-5H2,1H3 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.6449 |
| Density | 1.284g/cm3 |
| Melting point | 91.9℃ |
| Boiling point | 349.6°C at 760 mmHg |
| Flash point | 165.2°C |
| Refractive index | 1.568 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499770-73-9 4-methyl-3,4-dihydro-2h-1,4-benzoxazine-7-carbonyl chloride
service@apichina.com