| Product Name | 4-methyl-2-phenyl-5-pyrimidinecarboxylic acid |
| CAS No. | 103249-79-2 |
| Synonyms | 4-methyl-2-phenylpyrimidine-5-carboxylic acid |
| InChI | InChI=1/C12H10N2O2/c1-8-10(12(15)16)7-13-11(14-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,15,16) |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 |
| Density | 1.26g/cm3 |
| Melting point | 247℃ |
| Boiling point | 306.6°C at 760 mmHg |
| Flash point | 139.2°C |
| Refractive index | 1.608 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
103249-79-2 4-methyl-2-phenyl-5-pyrimidinecarboxylic acid
service@apichina.com