| Product Name | 4-methyl-2-phenyl-2-pentenal |
| CAS No. | 26643-91-4 |
| Synonyms | Benzeneacetaldehyde, alpha-(2-methylpropylidene)-; 2-Pentenal, 4-methyl-2-phenyl-; 4-Methyl-2-phenyl-2-pentenal; 4-Methyl-2-phenyl-2-penteral; 4-Methyl-2-phenyl-2-penteral (natural); FEMA No. 3200; alpha-(2-Methylpropylidene)benzeneacetaldehyde; alpha-Isobutylidenebenzeneacetaldehyde; 4-methyl-2-phenylpent-2-enal; (2Z)-4-methyl-2-phenylpent-2-enal; (2E)-4-methyl-2-phenylpent-2-enal |
| InChI | InChI=1/C12H14O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8- |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.239 |
| Density | 0.962g/cm3 |
| Boiling point | 295.1°C at 760 mmHg |
| Flash point | 113.9°C |
| Refractive index | 1.517 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
26643-91-4 4-methyl-2-phenyl-2-pentenal
service@apichina.com