| Product Name | 4-Methyl-2-nitrophenyl isothiocyanate |
| CAS No. | 17614-74-3 |
| Synonyms | 1-isothiocyanato-4-methyl-2-nitrobenzene |
| InChI | InChI=1/C8H6N2O2S/c1-6-2-3-7(9-5-13)8(4-6)10(11)12/h2-4H,1H3 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.2104 |
| Density | 1.28g/cm3 |
| Melting point | 61-65℃ |
| Boiling point | 347.3°C at 760 mmHg |
| Flash point | 163.8°C |
| Refractive index | 1.616 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
17614-74-3 4-methyl-2-nitrophenyl isothiocyanate
service@apichina.com