| Product Name | 4-methyl-2-(2-pyrazinyl)-1,3-thiazole-5-carbonyl chloride |
| CAS No. | 257876-11-2 |
| Synonyms | 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride |
| InChI | InChI=1/C9H6ClN3OS/c1-5-7(8(10)14)15-9(13-5)6-4-11-2-3-12-6/h2-4H,1H3 |
| Molecular Formula | C9H6ClN3OS |
| Molecular Weight | 239.6814 |
| Density | 1.439g/cm3 |
| Boiling point | 410.8°C at 760 mmHg |
| Flash point | 202.3°C |
| Refractive index | 1.62 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
257876-11-2 4-methyl-2-(2-pyrazinyl)-1,3-thiazole-5-carbonyl chloride
service@apichina.com