| Product Name | 4-Methyl-1-Piperazine Carboxaldehyde |
| CAS No. | 7556-55-0 |
| Synonyms | 1-Formyl-4-methylpiperazine; 1-Methyl-4-formylpiperazine~4-Methylpiperazine-1-carboxaldehyde; 4-methylpiperazine-1-carbaldehyde |
| InChI | InChI=1/C6H12N2O/c1-7-2-4-8(6-9)5-3-7/h6H,2-5H2,1H3 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.1723 |
| Density | 1.113g/cm3 |
| Boiling point | 231°C at 760 mmHg |
| Flash point | 98.5°C |
| Refractive index | 1.553 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7556-55-0 4-methyl-1-piperazine carboxaldehyde
service@apichina.com