| Product Name | 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
| CAS No. | 59944-65-9 |
| InChI | InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
| Molecular Formula | C4H3ClN2OS |
| Molecular Weight | 162.5974 |
| Density | 1.504g/cm3 |
| Boiling point | 239.9°C at 760 mmHg |
| Flash point | 98.9°C |
| Refractive index | 1.578 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
service@apichina.com