| Product Name | 4-Methoxyphenylglyoxal hydrate |
| CAS No. | 16208-17-6 |
| Synonyms | 4-methoxyphenylglyoxal hydrate, dry wt. Basis; 2,2-dihydroxy-1-(4-methoxyphenyl)ethanone |
| InChI | InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,9,11-12H,1H3 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.1733 |
| Density | 1.297g/cm3 |
| Boiling point | 335°C at 760 mmHg |
| Flash point | 136.2°C |
| Refractive index | 1.569 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16208-17-6 4-methoxyphenylglyoxal hydrate
service@apichina.com