| Product Name | 4-methoxyphenylacetyl chloride |
| CAS No. | 4693-91-8 |
| Synonyms | Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
| InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.6196 |
| Density | 1.192g/cm3 |
| Boiling point | 280.1°C at 760 mmHg |
| Flash point | 100°C |
| Refractive index | 1.524 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4693-91-8 4-methoxyphenylacetyl chloride
service@apichina.com