| Product Name | 4-Methoxyphenoxyacetonitrile |
| CAS No. | 22446-12-4 |
| InChI | InChI=1/C9H9NO2/c1-11-8-2-4-9(5-3-8)12-7-6-10/h2-5H,7H2,1H3 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.1733 |
| Density | 1.107g/cm3 |
| Boiling point | 293.8°C at 760 mmHg |
| Flash point | 122.1°C |
| Refractive index | 1.511 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
22446-12-4 4-methoxyphenoxyacetonitrile
service@apichina.com