| Product Name | 4-methoxymandelic acid |
| CAS No. | 10502-44-0 |
| Synonyms | alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
| InChI | InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.1733 |
| Density | 1.309g/cm3 |
| Melting point | 108-111℃ |
| Boiling point | 370.4°C at 760 mmHg |
| Flash point | 152.6°C |
| Refractive index | 1.569 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10502-44-0 4-methoxymandelic acid
service@apichina.com