| Product Name | 4-Methoxycinnamonitrile, mixture of cis- and trans isomers |
| CAS No. | 28446-68-6 |
| Synonyms | 4-Methoxycinnamonitrile; 3-(4-methoxyphenyl)prop-2-enenitrile; (2E)-3-(4-methoxyphenyl)prop-2-enenitrile |
| InChI | InChI=1/C10H9NO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-7H,1H3/b3-2+ |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.077g/cm3 |
| Boiling point | 327.8°C at 760 mmHg |
| Flash point | 131.6°C |
| Refractive index | 1.573 |
| Hazard Symbols | |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
28446-68-6 4-methoxycinnamonitrile, mixture of cis- and trans isomers
service@apichina.com