| Product Name | 4-Methoxybenzylidenecyanoacetic acid |
| CAS No. | 1519-55-7 |
| Synonyms | alpha-Cyano-4-methoxycinnamic acid; (2E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoic acid; (2Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoic acid |
| InChI | InChI=1/C11H9NO3/c1-15-10-4-2-8(3-5-10)6-9(7-12)11(13)14/h2-6H,1H3,(H,13,14)/b9-6- |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.1941 |
| Density | 1.28g/cm3 |
| Boiling point | 392.8°C at 760 mmHg |
| Flash point | 191.4°C |
| Refractive index | 1.606 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1519-55-7 4-methoxybenzylidenecyanoacetic acid
service@apichina.com