Product Name | 4-methoxybenzyl carbazate |
CAS No. | 18912-37-3 |
Synonyms | 4-Methoxybenzyl hydrazinocarboxylate~(4-Methoxybenzyl)oxyhydrazine; 4-methoxybenzyl hydrazinecarboxylate |
InChI | InChI=1/C9H12N2O3/c1-13-8-4-2-7(3-5-8)6-14-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12) |
Molecular Formula | C9H12N2O3 |
Molecular Weight | 196.2032 |
Density | 1.209g/cm3 |
Melting point | 75-77℃ |
Boiling point | 391.1°C at 760 mmHg |
Flash point | 190.3°C |
Refractive index | 1.546 |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18912-37-3 4-methoxybenzyl carbazate
service@apichina.com