| Product Name | 4-Methoxybenzenediazonium tetrafluoroborate |
| CAS No. | 459-64-3 |
| Synonyms | 4-Methoxybenzenediazoniumfluoroborate; 4-methoxybenzenediazonium; boron(+3) cation; 4-methoxybenzenediazonium; tetrafluoride |
| InChI | InChI=1/C7H7N2O.B.4FH/c1-10-7-4-2-6(9-8)3-5-7;;;;;/h2-5H,1H3;;4*1H/q+1;+3;;;;/p-4 |
| Molecular Formula | C7H7BF4N2O |
| Molecular Weight | 221.9479 |
| Melting point | 140-144℃ |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
459-64-3 4-methoxybenzenediazonium tetrafluoroborate
service@apichina.com