| Product Name | 4-Methoxy-o-phenylenediamine dihydrochloride |
| CAS No. | 59548-39-9 |
| Synonyms | 3,4-Diaminoanisole dihydrochloride; 4-methoxybenzene-1,2-diamine dihydrochloride |
| InChI | InChI=1/C7H10N2O.2ClH/c1-10-5-2-3-6(8)7(9)4-5;;/h2-4H,8-9H2,1H3;2*1H |
| Molecular Formula | C7H12Cl2N2O |
| Molecular Weight | 211.089 |
| Melting point | 210-209℃ |
| Boiling point | 302.4°C at 760 mmHg |
| Flash point | 161.7°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
59548-39-9 4-methoxy-o-phenylenediamine dihydrochloride
service@apichina.com