| Product Name | 4-methoxy-6-[2-(thiophen-2-yl)ethenyl]-2H-pyran-2-one |
| CAS No. | 60427-80-7 |
| InChI | InChI=1/C12H10O3S/c1-14-10-7-9(15-12(13)8-10)4-5-11-3-2-6-16-11/h2-8H,1H3 |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.271 |
| Density | 1.28g/cm3 |
| Boiling point | 455.3°C at 760 mmHg |
| Flash point | 229.1°C |
| Refractive index | 1.605 |
60427-80-7 4-methoxy-6-[2-(thiophen-2-yl)ethenyl]-2h-pyran-2-one
service@apichina.com