| Product Name | 4-Methoxy-3-pyrrolin-2-one |
| CAS No. | 69778-83-2 |
| Synonyms | 1,5-Dihydro-4-methoxy-2H-pyrrol-2-on; 4-methoxy-1,5-dihydro-2H-pyrrol-2-one |
| InChI | InChI=1/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7) |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.1146 |
| Density | 1.16g/cm3 |
| Melting point | 130-133℃ |
| Boiling point | 349.6°C at 760 mmHg |
| Flash point | 165.2°C |
| Refractive index | 1.495 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
69778-83-2 4-methoxy-3-pyrrolin-2-one
service@apichina.com