| Product Name | 4-Methoxy-3-nitropyridine hydrochloride |
| CAS No. | 31872-61-4 |
| Synonyms | 3-Nitro-4-methoxypyridine hydrochloride; 4-methoxy-3-nitropyridine hydrochloride (1:1) |
| InChI | InChI:1S/C6H6N2O3.ClH/c1-11-6-2-3-7-4-5(6)8(9)10;/h2-4H,1H3;1H |
| Molecular Formula | C6H7N2O3Cl |
| Molecular Weight | 190.5861 |
| Density | 1.3g/cm3 |
| Boiling point | 275.9°C at 760 mmHg |
| Flash point | 120.7°C |
| Refractive index | 1.546 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
31872-61-4 4-methoxy-3-nitropyridine hydrochloride
service@apichina.com