| Product Name | 4-methoxy-3-nitrobenzonitrile |
| CAS No. | 33224-23-6 |
| InChI | InChI=1/C8H6N2O3/c1-13-8-3-2-6(5-9)4-7(8)10(11)12/h2-4H,1H3 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.1448 |
| Density | 1.32g/cm3 |
| Melting point | 148℃ |
| Boiling point | 330.2°C at 760 mmHg |
| Flash point | 153.5°C |
| Refractive index | 1.563 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
33224-23-6 4-methoxy-3-nitrobenzonitrile
service@apichina.com