| Product Name | 4-methoxy-3-nitrobenzene-1-carbothioamide |
| CAS No. | 175277-84-6 |
| Synonyms | 4-methoxy-3-nitrobenzenecarbothioamide |
| InChI | InChI=1/C8H8N2O3S/c1-13-7-3-2-5(8(9)14)4-6(7)10(11)12/h2-4H,1H3,(H2,9,14) |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.2257 |
| Density | 1.397g/cm3 |
| Melting point | 197℃ |
| Boiling point | 381.7°C at 760 mmHg |
| Flash point | 184.7°C |
| Refractive index | 1.654 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175277-84-6 4-methoxy-3-nitrobenzene-1-carbothioamide
service@apichina.com