| Product Name | (4-Methoxy-3-methylphenyl)boronic acid |
| CAS No. | 175883-62-2 |
| Synonyms | 4-Methoxy-3-methylphenylboronic acid; 4-Methoxy-3-methylbenzeneboronic acid |
| InChI | InChI=1/C8H11BO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5,10-11H,1-2H3 |
| Molecular Formula | C8H11BO3 |
| Molecular Weight | 165.9821 |
| Density | 1.14g/cm3 |
| Boiling point | 321.4°C at 760 mmHg |
| Flash point | 148.2°C |
| Refractive index | 1.52 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
175883-62-2 (4-methoxy-3-methylphenyl)boronic acid
service@apichina.com