| Product Name | 4-Methoxy-2-methylphenylhydrazine hydrochloride |
| CAS No. | 93048-16-9 |
| InChI | InChI=1/C8H12N2O.ClH/c1-6-5-7(11-2)3-4-8(6)10-9;/h3-5,10H,9H2,1-2H3;1H |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.6546 |
| Boiling point | 303.4°C at 760 mmHg |
| Flash point | 137.3°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
93048-16-9 4-methoxy-2-methylphenylhydrazine hydrochloride
service@apichina.com