| Product Name | 4-(Methanesulphinyl)benzeneboronic acid |
| CAS No. | 166386-48-7 |
| Synonyms | 4-Boronophenyl methyl sulphoxide~4-(Methylsulphinyl)phenylboronic acid; [4-(methylsulfinyl)phenyl]boronic acid |
| InChI | InChI=1/C7H9BO3S/c1-12(11)7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3 |
| Molecular Formula | C7H9BO3S |
| Molecular Weight | 184.0206 |
| Density | 1.37g/cm3 |
| Boiling point | 416.8°C at 760 mmHg |
| Flash point | 205.9°C |
| Refractive index | 1.616 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
166386-48-7 4-(methanesulphinyl)benzeneboronic acid
service@apichina.com