| Product Name | 4-Ketopimelic acid |
| CAS No. | 502-50-1 |
| Synonyms | 4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
| InChI | InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.1365 |
| Melting point | 142-144℃ |
| Boiling point | 420.4°C at 760 mmHg |
| Flash point | 222.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
502-50-1 4-ketopimelic acid
service@apichina.com