| Product Name | 4-Isopropylphenylacetonitrile |
| CAS No. | 4395-87-3 |
| Synonyms | [4-(propan-2-yl)phenyl]acetonitrile |
| InChI | InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.2276 |
| Density | 0.96g/cm3 |
| Boiling point | 261.1°C at 760 mmHg |
| Flash point | 117.5°C |
| Refractive index | 1.514 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
4395-87-3 4-isopropylphenylacetonitrile
service@apichina.com