| Product Name | 4-Isopropylphenylacetic acid |
| CAS No. | 4476-28-2 |
| Synonyms | AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| InChI | InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| Molecular Formula | C11H13O2 |
| Molecular Weight | 177.2203 |
| Boiling point | 295°C at 760 mmHg |
| Flash point | 192.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4476-28-2 4-isopropylphenylacetic acid
service@apichina.com