| Product Name | 4-Isopropylphenoxyacetic acid |
| CAS No. | 1643-16-9 |
| Synonyms | [4-(propan-2-yl)phenoxy]acetic acid |
| InChI | InChI=1/C11H14O3/c1-8(2)9-3-5-10(6-4-9)14-7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13) |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.2271 |
| Density | 1.112g/cm3 |
| Boiling point | 315.2°C at 760 mmHg |
| Flash point | 120°C |
| Refractive index | 1.522 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1643-16-9 4-isopropylphenoxyacetic acid
service@apichina.com