| Product Name | 4-Isopropylnitrobenzene |
| CAS No. | 1817-47-6 |
| Synonyms | 4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene; 1-nitro-4-(propan-2-yl)benzene |
| InChI | InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.091g/cm3 |
| Boiling point | 236.4°C at 760 mmHg |
| Flash point | 99.9°C |
| Refractive index | 1.533 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
1817-47-6 4-isopropylnitrobenzene
service@apichina.com