| Product Name | 4-Isopropylbenzyl chloride |
| CAS No. | 2051-18-5 |
| Synonyms | Benzene, 1-(chloromethyl)-4-(1-methylethyl)-; Benzene, 1-(chloromethyl)-4-(methylethyl)-; NSC 33915; p-Cymene, 7-chloro-; p-Isopropyl benzyl chloride; p-Isopropylbenzyl chloride; 7-Chloro-p-cymene; 1-(chloromethyl)-4-(propan-2-yl)benzene |
| InChI | InChI=1/C10H13Cl/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,7H2,1-2H3 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.6632 |
| Density | 1.008g/cm3 |
| Boiling point | 228.2°C at 760 mmHg |
| Flash point | 88.6°C |
| Refractive index | 1.512 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2051-18-5 4-isopropylbenzyl chloride
service@apichina.com