| Product Name | 4-Isopropylbenzonitrile |
| CAS No. | 13816-33-6 |
| Synonyms | 4-Cyanocumene; 4-(propan-2-yl)benzonitrile |
| InChI | InChI=1/C10H11N/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,1-2H3 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.201 |
| Density | 0.96g/cm3 |
| Boiling point | 231.5°C at 760 mmHg |
| Flash point | 93.6°C |
| Refractive index | 1.515 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13816-33-6 4-isopropylbenzonitrile
service@apichina.com