| Product Name | 4-Isopropylbenzeneboronic acid |
| CAS No. | 16152-51-5 |
| Synonyms | 4-Cumylboronic acid; [4-(1-methylethyl)phenyl]boronic acid; 4-Isopropylphenylboronic acid; 4-Isoprophenylboronic Acid |
| InChI | InChI=1/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.0093 |
| Density | 1.04g/cm3 |
| Boiling point | 285.9°C at 760 mmHg |
| Flash point | 126.7°C |
| Refractive index | 1.513 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16152-51-5 4-isopropylbenzeneboronic acid
service@apichina.com