| Product Name | 4-(isopropylamino)-3-nitrobenzonitrile |
| CAS No. | 355022-17-2 |
| Synonyms | 4-[(1-methylethyl)amino]-3-nitrobenzonitrile |
| InChI | InChI=1/C10H11N3O2/c1-7(2)12-9-4-3-8(6-11)5-10(9)13(14)15/h3-5,7,12H,1-2H3 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.2132 |
| Density | 1.21g/cm3 |
| Melting point | 113℃ |
| Boiling point | 347.4°C at 760 mmHg |
| Flash point | 163.9°C |
| Refractive index | 1.56 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
service@apichina.com