| Product Name | 4-isocyanato-3-methyl-5-phenylisoxazole |
| CAS No. | 352018-89-4 |
| InChI | InChI=1/C11H8N2O2/c1-8-10(12-7-14)11(15-13-8)9-5-3-2-4-6-9/h2-6H,1H3 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.1934 |
| Density | 1.21g/cm3 |
| Melting point | 81℃ |
| Boiling point | 347.7°C at 760 mmHg |
| Flash point | 164.1°C |
| Refractive index | 1.598 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
352018-89-4 4-isocyanato-3-methyl-5-phenylisoxazole
service@apichina.com